C19H21N7 — CID 89329417
4-N-[3-[3-(aminomethyl)phenyl]-5-methanimidoyl-4-(methylamino)phenyl]pyrimidine-2,4-diamine (PubChem CID 89329417) has the molecular formula C19H21N7 and a molecular weight of 347.43 g/mol. Its IUPAC name is 4-N-[3-[3-(aminomethyl)phenyl]-5-methanimidoyl-4-(methylamino)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-[3-(aminomethyl)phenyl]-5-methanimidoyl-4-(methylamino)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89329417 |
| Molecular Formula | C19H21N7 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 4-N-[3-[3-(aminomethyl)phenyl]-5-methanimidoyl-4-(methylamino)phenyl]pyrimidine-2,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ccnc(N)n2)cc(-c2cccc(CN)c2)c1NC |
| InChI | InChI=1S/C19H21N7/c1-23-18-14(11-21)8-15(25-17-5-6-24-19(22)26-17)9-16(18)13-4-2-3-12(7-13)10-20/h2-9,11,21,23H,10,20H2,1H3,(H3,22,24,25,26)/b21-11+ |
| InChIKey | OKGJEOYHGJFWPC-SRZZPIQSSA-N |
| XLogP | 2.97 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|