About acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine
acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine (PubChem CID 159948025) has the molecular formula C24H27N5O6S
and a molecular weight of 513.58 g/mol. Its IUPAC name is acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine |
| PubChem CID | 159948025 |
| Molecular Formula | C24H27N5O6S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine |
| SMILES | CC(=O)O.CC(=O)O.CS(=O)(=O)Cc1cccc(-c2cc(Nc3ccnc(N)n3)cc3c2CN=C3)c1 |
| InChI | InChI=1S/C20H19N5O2S.2C2H4O2/c1-28(26,27)12-13-3-2-4-14(7-13)17-9-16(8-15-10-22-11-18(15)17)24-19-5-6-23-20(21)25-19;2*1-2(3)4/h2-10H,11-12H2,1H3,(H3,21,23,24,25);2*1H3,(H,3,4) |
| InChIKey | ZZGGNQDONGZNLZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 184.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine?
The IUPAC name of acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine (CID 159948025) is acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine.
What is the SMILES notation for acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine?
The canonical SMILES for acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine is CC(=O)O.CC(=O)O.CS(=O)(=O)Cc1cccc(-c2cc(Nc3ccnc(N)n3)cc3c2CN=C3)c1.
What is the InChIKey of acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine?
The InChIKey is ZZGGNQDONGZNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5O2S.2C2H4O2/c1-28(26,27)12-13-3-2-4-14(7-13)17-9-16(8-15-10-22-11-18(15)17)24-19-5-6-23-20(21)25-19;2*1-2(3)4/h2-10H,11-12H2,1H3,(H3,21,23,24,25);2*1H3,(H,3,4).
What are the key properties of acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine?
acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine has a molecular weight of 513.58 g/mol, XLogP of 3.13, 5 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-N-[7-[3-(methylsulfonylmethyl)phenyl]-1H-isoindol-5-yl]pyrimidine-2,4-diamine is sourced from PubChem (CID 159948025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).