C18H20N6O3 — CID 157480992
acetic acid;5-[5-[(2-aminopyrimidin-4-yl)amino]-1H-indazol-7-yl]pent-4-yn-1-ol (PubChem CID 157480992) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is acetic acid;5-[5-[(2-aminopyrimidin-4-yl)amino]-1H-indazol-7-yl]pent-4-yn-1-ol.
| Compound Name | acetic acid;5-[5-[(2-aminopyrimidin-4-yl)amino]-1H-indazol-7-yl]pent-4-yn-1-ol |
|---|---|
| PubChem CID | 157480992 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | acetic acid;5-[5-[(2-aminopyrimidin-4-yl)amino]-1H-indazol-7-yl]pent-4-yn-1-ol |
| SMILES | CC(=O)O.Nc1nccc(Nc2cc(C#CCCCO)c3[nH]ncc3c2)n1 |
| InChI | InChI=1S/C16H16N6O.C2H4O2/c17-16-18-6-5-14(21-16)20-13-8-11(4-2-1-3-7-23)15-12(9-13)10-19-22-15;1-2(3)4/h5-6,8-10,23H,1,3,7H2,(H,19,22)(H3,17,18,20,21);1H3,(H,3,4) |
| InChIKey | AOKJNPGOOPCZFC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|