C11H15N3O — CID 156811982
N-(3-amino-2-methanimidoylphenyl)-2-methylpropanamide (PubChem CID 156811982) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(3-amino-2-methanimidoylphenyl)-2-methylpropanamide.
| Compound Name | N-(3-amino-2-methanimidoylphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 156811982 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-(3-amino-2-methanimidoylphenyl)-2-methylpropanamide |
| SMILES | [H]/N=C/c1c(N)cccc1NC(=O)C(C)C |
| InChI | InChI=1S/C11H15N3O/c1-7(2)11(15)14-10-5-3-4-9(13)8(10)6-12/h3-7,12H,13H2,1-2H3,(H,14,15)/b12-6+ |
| InChIKey | DQCXKEBGDHCHSG-WUXMJOGZSA-N |
| XLogP | 1.86 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|