C19H34N4O5 — CID 163775440
N-(2-aminophenyl)-2-methylpropanamide;N-hydroxy-2-methylpropanamide;N-methoxy-2-methylpropanamide (PubChem CID 163775440) has the molecular formula C19H34N4O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-methylpropanamide;N-hydroxy-2-methylpropanamide;N-methoxy-2-methylpropanamide.
| Compound Name | N-(2-aminophenyl)-2-methylpropanamide;N-hydroxy-2-methylpropanamide;N-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 163775440 |
| Molecular Formula | C19H34N4O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | N-(2-aminophenyl)-2-methylpropanamide;N-hydroxy-2-methylpropanamide;N-methoxy-2-methylpropanamide |
| SMILES | CC(C)C(=O)NO.CC(C)C(=O)Nc1ccccc1N.CONC(=O)C(C)C |
| InChI | InChI=1S/C10H14N2O.C5H11NO2.C4H9NO2/c1-7(2)10(13)12-9-6-4-3-5-8(9)11;1-4(2)5(7)6-8-3;1-3(2)4(6)5-7/h3-7H,11H2,1-2H3,(H,12,13);4H,1-3H3,(H,6,7);3,7H,1-2H3,(H,5,6) |
| InChIKey | MKAIFWYJNVWNIH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|