C12H20ClN3O2 — CID 90713192
(2S)-N-(2-aminophenyl)-3-methoxy-2-(methylamino)propanamide;chloromethane (PubChem CID 90713192) has the molecular formula C12H20ClN3O2 and a molecular weight of 273.76 g/mol. Its IUPAC name is (2S)-N-(2-aminophenyl)-3-methoxy-2-(methylamino)propanamide;chloromethane.
| Compound Name | (2S)-N-(2-aminophenyl)-3-methoxy-2-(methylamino)propanamide;chloromethane |
|---|---|
| PubChem CID | 90713192 |
| Molecular Formula | C12H20ClN3O2 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2S)-N-(2-aminophenyl)-3-methoxy-2-(methylamino)propanamide;chloromethane |
| SMILES | CCl.CN[C@@H](COC)C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C11H17N3O2.CH3Cl/c1-13-10(7-16-2)11(15)14-9-6-4-3-5-8(9)12;1-2/h3-6,10,13H,7,12H2,1-2H3,(H,14,15);1H3/t10-;/m0./s1 |
| InChIKey | HXWIMKDWRJKVCB-PPHPATTJSA-N |
| XLogP | 1.30 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|