C11H17ClN2O2 — CID 119422032
N-(2-aminophenyl)-4-methoxybutanamide;hydrochloride (PubChem CID 119422032) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-methoxybutanamide;hydrochloride.
| Compound Name | N-(2-aminophenyl)-4-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 119422032 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(2-aminophenyl)-4-methoxybutanamide;hydrochloride |
| SMILES | COCCCC(=O)Nc1ccccc1N.Cl |
| InChI | InChI=1S/C11H16N2O2.ClH/c1-15-8-4-7-11(14)13-10-6-3-2-5-9(10)12;/h2-3,5-6H,4,7-8,12H2,1H3,(H,13,14);1H |
| InChIKey | UGSQVSJJBBYMSZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|