C23H30N2O4 — CID 149460291
N-(2-aminophenyl)-8-[2-(2-methoxyethoxy)phenyl]-8-oxooctanamide (PubChem CID 149460291) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-8-[2-(2-methoxyethoxy)phenyl]-8-oxooctanamide.
| Compound Name | N-(2-aminophenyl)-8-[2-(2-methoxyethoxy)phenyl]-8-oxooctanamide |
|---|---|
| PubChem CID | 149460291 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-(2-aminophenyl)-8-[2-(2-methoxyethoxy)phenyl]-8-oxooctanamide |
| SMILES | COCCOc1ccccc1C(=O)CCCCCCC(=O)Nc1ccccc1N |
| InChI | InChI=1S/C23H30N2O4/c1-28-16-17-29-22-14-9-6-10-18(22)21(26)13-4-2-3-5-15-23(27)25-20-12-8-7-11-19(20)24/h6-12,14H,2-5,13,15-17,24H2,1H3,(H,25,27) |
| InChIKey | YZJJEDFMDBCSER-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|