C20H22F3N3O3 — CID 45256999
N-(2-aminophenyl)-N'-[2-(trifluoromethoxy)phenyl]heptanediamide (PubChem CID 45256999) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-(2-aminophenyl)-N'-[2-(trifluoromethoxy)phenyl]heptanediamide.
| Compound Name | N-(2-aminophenyl)-N'-[2-(trifluoromethoxy)phenyl]heptanediamide |
|---|---|
| PubChem CID | 45256999 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(2-aminophenyl)-N'-[2-(trifluoromethoxy)phenyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H22F3N3O3/c21-20(22,23)29-17-11-7-6-10-16(17)26-19(28)13-3-1-2-12-18(27)25-15-9-5-4-8-14(15)24/h4-11H,1-3,12-13,24H2,(H,25,27)(H,26,28) |
| InChIKey | SGRWIFGAXZDXOB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|