C16H17IN2O2 — CID 43327303
N-(2-aminophenyl)-4-(4-iodophenoxy)butanamide (PubChem CID 43327303) has the molecular formula C16H17IN2O2 and a molecular weight of 396.23 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-(4-iodophenoxy)butanamide.
| Compound Name | N-(2-aminophenyl)-4-(4-iodophenoxy)butanamide |
|---|---|
| PubChem CID | 43327303 |
| Molecular Formula | C16H17IN2O2 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-(2-aminophenyl)-4-(4-iodophenoxy)butanamide |
| SMILES | Nc1ccccc1NC(=O)CCCOc1ccc(I)cc1 |
| InChI | InChI=1S/C16H17IN2O2/c17-12-7-9-13(10-8-12)21-11-3-6-16(20)19-15-5-2-1-4-14(15)18/h1-2,4-5,7-10H,3,6,11,18H2,(H,19,20) |
| InChIKey | YXLADWRYQJSPIN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|