C18H24F3N5 — CID 176553239
N-(3-amino-2-methanimidoylphenyl)-N'-[(1E,3E)-1-(methylamino)-2-(trifluoromethyl)hepta-1,3-dienyl]ethanimidamide (PubChem CID 176553239) has the molecular formula C18H24F3N5 and a molecular weight of 367.42 g/mol. Its IUPAC name is N-(3-amino-2-methanimidoylphenyl)-N'-[(1E,3E)-1-(methylamino)-2-(trifluoromethyl)hepta-1,3-dienyl]ethanimidamide.
| Compound Name | N-(3-amino-2-methanimidoylphenyl)-N'-[(1E,3E)-1-(methylamino)-2-(trifluoromethyl)hepta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 176553239 |
| Molecular Formula | C18H24F3N5 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-(3-amino-2-methanimidoylphenyl)-N'-[(1E,3E)-1-(methylamino)-2-(trifluoromethyl)hepta-1,3-dienyl]ethanimidamide |
| SMILES | [H]/N=C/c1c(N)cccc1N/C(C)=N/C(NC)=C(\C=C\CCC)C(F)(F)F |
| InChI | InChI=1S/C18H24F3N5/c1-4-5-6-8-14(18(19,20)21)17(24-3)26-12(2)25-16-10-7-9-15(23)13(16)11-22/h6-11,22,24H,4-5,23H2,1-3H3,(H,25,26)/b8-6+,17-14+,22-11+ |
| InChIKey | UIRPHCORZJROFT-YLRAMCFHSA-N |
| XLogP | 4.45 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|