C8H10ClN3 — CID 134297751
2-chloro-3-methanimidoyl-1-N-methylbenzene-1,4-diamine (PubChem CID 134297751) has the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. Its IUPAC name is 2-chloro-3-methanimidoyl-1-N-methylbenzene-1,4-diamine.
| Compound Name | 2-chloro-3-methanimidoyl-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 134297751 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-chloro-3-methanimidoyl-1-N-methylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1c(N)ccc(NC)c1Cl |
| InChI | InChI=1S/C8H10ClN3/c1-12-7-3-2-6(11)5(4-10)8(7)9/h2-4,10,12H,11H2,1H3/b10-4+ |
| InChIKey | YFCIPSBQSWIHDX-ONNFQVAWSA-N |
| XLogP | 1.96 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|