C17H17ClN6O — CID 167157721
2-chloro-1-N-[5-(4-ethoxyphenyl)-1H-1,2,4-triazol-3-yl]-3-methanimidoylbenzene-1,4-diamine (PubChem CID 167157721) has the molecular formula C17H17ClN6O and a molecular weight of 356.82 g/mol. Its IUPAC name is 2-chloro-1-N-[5-(4-ethoxyphenyl)-1H-1,2,4-triazol-3-yl]-3-methanimidoylbenzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-[5-(4-ethoxyphenyl)-1H-1,2,4-triazol-3-yl]-3-methanimidoylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 167157721 |
| Molecular Formula | C17H17ClN6O |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-chloro-1-N-[5-(4-ethoxyphenyl)-1H-1,2,4-triazol-3-yl]-3-methanimidoylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2n[nH]c(-c3ccc(OCC)cc3)n2)c1Cl |
| InChI | InChI=1S/C17H17ClN6O/c1-2-25-11-5-3-10(4-6-11)16-22-17(24-23-16)21-14-8-7-13(20)12(9-19)15(14)18/h3-9,19H,2,20H2,1H3,(H2,21,22,23,24)/b19-9+ |
| InChIKey | FTWKFROCUITQRT-DJKKODMXSA-N |
| XLogP | 3.85 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|