C16H15ClFN5O — CID 130429224
5-(3-amino-4-methoxyphenyl)-N-[(2-chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine (PubChem CID 130429224) has the molecular formula C16H15ClFN5O and a molecular weight of 347.78 g/mol. Its IUPAC name is 5-(3-amino-4-methoxyphenyl)-N-[(2-chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(3-amino-4-methoxyphenyl)-N-[(2-chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 130429224 |
| Molecular Formula | C16H15ClFN5O |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 5-(3-amino-4-methoxyphenyl)-N-[(2-chloro-6-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine |
| SMILES | COc1ccc(-c2nc(NCc3c(F)cccc3Cl)n[nH]2)cc1N |
| InChI | InChI=1S/C16H15ClFN5O/c1-24-14-6-5-9(7-13(14)19)15-21-16(23-22-15)20-8-10-11(17)3-2-4-12(10)18/h2-7H,8,19H2,1H3,(H2,20,21,22,23) |
| InChIKey | LMAZTHVENPJMML-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|