C19H15ClFN5O — CID 130429217
N-[3-[3-[(2-chloro-6-fluorophenyl)methylamino]-1H-1,2,4-triazol-5-yl]phenyl]but-2-ynamide (PubChem CID 130429217) has the molecular formula C19H15ClFN5O and a molecular weight of 383.81 g/mol. Its IUPAC name is N-[3-[3-[(2-chloro-6-fluorophenyl)methylamino]-1H-1,2,4-triazol-5-yl]phenyl]but-2-ynamide.
| Compound Name | N-[3-[3-[(2-chloro-6-fluorophenyl)methylamino]-1H-1,2,4-triazol-5-yl]phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 130429217 |
| Molecular Formula | C19H15ClFN5O |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-[3-[3-[(2-chloro-6-fluorophenyl)methylamino]-1H-1,2,4-triazol-5-yl]phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1cccc(-c2nc(NCc3c(F)cccc3Cl)n[nH]2)c1 |
| InChI | InChI=1S/C19H15ClFN5O/c1-2-5-17(27)23-13-7-3-6-12(10-13)18-24-19(26-25-18)22-11-14-15(20)8-4-9-16(14)21/h3-4,6-10H,11H2,1H3,(H,23,27)(H2,22,24,25,26) |
| InChIKey | FOPXIFSZOYXVHS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|