About N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine
N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 137177816) has the molecular formula C13H11ClFN5
and a molecular weight of 291.72 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine |
| PubChem CID | 137177816 |
| Molecular Formula | C13H11ClFN5 |
| Molecular Weight | 291.72 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | Fc1cccc(Cl)c1CNc1n[nH]c(-c2ccc[nH]2)n1 |
| InChI | InChI=1S/C13H11ClFN5/c14-9-3-1-4-10(15)8(9)7-17-13-18-12(19-20-13)11-5-2-6-16-11/h1-6,16H,7H2,(H2,17,18,19,20) |
| InChIKey | JUGSFTANZOOEDV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine?
The IUPAC name of N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine (CID 137177816) is N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine?
The canonical SMILES for N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine is Fc1cccc(Cl)c1CNc1n[nH]c(-c2ccc[nH]2)n1.
What is the InChIKey of N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine?
The InChIKey is JUGSFTANZOOEDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClFN5/c14-9-3-1-4-10(15)8(9)7-17-13-18-12(19-20-13)11-5-2-6-16-11/h1-6,16H,7H2,(H2,17,18,19,20).
What are the key properties of N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine?
N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine has a molecular weight of 291.72 g/mol, XLogP of 3.20, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-6-fluorophenyl)methyl]-5-(1H-pyrrol-2-yl)-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 137177816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).