C9H13N3 — CID 146283933
4-methanimidoyl-3-N,6-dimethylbenzene-1,3-diamine (PubChem CID 146283933) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-methanimidoyl-3-N,6-dimethylbenzene-1,3-diamine.
| Compound Name | 4-methanimidoyl-3-N,6-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 146283933 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 4-methanimidoyl-3-N,6-dimethylbenzene-1,3-diamine |
| SMILES | [H]/N=C/c1cc(C)c(N)cc1NC |
| InChI | InChI=1S/C9H13N3/c1-6-3-7(5-10)9(12-2)4-8(6)11/h3-5,10,12H,11H2,1-2H3/b10-5+ |
| InChIKey | SCSYEMBBXNAJHB-BJMVGYQFSA-N |
| XLogP | 1.62 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|