C11H16N2 — CID 164587046
4-ethenyl-3-N-ethyl-6-methylbenzene-1,3-diamine (PubChem CID 164587046) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-ethenyl-3-N-ethyl-6-methylbenzene-1,3-diamine.
| Compound Name | 4-ethenyl-3-N-ethyl-6-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 164587046 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 4-ethenyl-3-N-ethyl-6-methylbenzene-1,3-diamine |
| SMILES | C=Cc1cc(C)c(N)cc1NCC |
| InChI | InChI=1S/C11H16N2/c1-4-9-6-8(3)10(12)7-11(9)13-5-2/h4,6-7,13H,1,5,12H2,2-3H3 |
| InChIKey | SGKHYWLLTMIHSW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|