C11H17BrN2 — CID 174639511
2-bromo-1-N,3-N-diethyl-5-methylbenzene-1,3-diamine (PubChem CID 174639511) has the molecular formula C11H17BrN2 and a molecular weight of 257.17 g/mol. Its IUPAC name is 2-bromo-1-N,3-N-diethyl-5-methylbenzene-1,3-diamine.
| Compound Name | 2-bromo-1-N,3-N-diethyl-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 174639511 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-bromo-1-N,3-N-diethyl-5-methylbenzene-1,3-diamine |
| SMILES | CCNc1cc(C)cc(NCC)c1Br |
| InChI | InChI=1S/C11H17BrN2/c1-4-13-9-6-8(3)7-10(11(9)12)14-5-2/h6-7,13-14H,4-5H2,1-3H3 |
| InChIKey | PANZWAXAKBPVNY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |