C14H17N5 — CID 145270369
4-[[4-methanimidoyl-3-(methylamino)phenyl]methyl]pyridine-2,6-diamine (PubChem CID 145270369) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-[[4-methanimidoyl-3-(methylamino)phenyl]methyl]pyridine-2,6-diamine.
| Compound Name | 4-[[4-methanimidoyl-3-(methylamino)phenyl]methyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 145270369 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-[[4-methanimidoyl-3-(methylamino)phenyl]methyl]pyridine-2,6-diamine |
| SMILES | [H]/N=C/c1ccc(Cc2cc(N)nc(N)c2)cc1NC |
| InChI | InChI=1S/C14H17N5/c1-18-12-5-9(2-3-11(12)8-15)4-10-6-13(16)19-14(17)7-10/h2-3,5-8,15,18H,4H2,1H3,(H4,16,17,19)/b15-8+ |
| InChIKey | TVUDOMRYEBCOJY-OVCLIPMQSA-N |
| XLogP | 1.88 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|