C21H21N3O4 — CID 144624243
(3S)-3-[4-[[4-methanimidoyl-3-(methylamino)phenyl]methoxy]phenyl]-3-(1,2-oxazol-3-yl)propanoic acid (PubChem CID 144624243) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (3S)-3-[4-[[4-methanimidoyl-3-(methylamino)phenyl]methoxy]phenyl]-3-(1,2-oxazol-3-yl)propanoic acid.
| Compound Name | (3S)-3-[4-[[4-methanimidoyl-3-(methylamino)phenyl]methoxy]phenyl]-3-(1,2-oxazol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 144624243 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (3S)-3-[4-[[4-methanimidoyl-3-(methylamino)phenyl]methoxy]phenyl]-3-(1,2-oxazol-3-yl)propanoic acid |
| SMILES | [H]/N=C/c1ccc(COc2ccc([C@H](CC(=O)O)c3ccon3)cc2)cc1NC |
| InChI | InChI=1S/C21H21N3O4/c1-23-20-10-14(2-3-16(20)12-22)13-27-17-6-4-15(5-7-17)18(11-21(25)26)19-8-9-28-24-19/h2-10,12,18,22-23H,11,13H2,1H3,(H,25,26)/b22-12+/t18-/m0/s1 |
| InChIKey | VNYRQLLCQZMSPW-YPKZHZFPSA-N |
| XLogP | 3.90 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|