C26H25N3O3 — CID 144624323
(3S)-3-[4-[[4-methanimidoyl-3-(pyridin-3-ylmethylamino)phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 144624323) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is (3S)-3-[4-[[4-methanimidoyl-3-(pyridin-3-ylmethylamino)phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[4-methanimidoyl-3-(pyridin-3-ylmethylamino)phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 144624323 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (3S)-3-[4-[[4-methanimidoyl-3-(pyridin-3-ylmethylamino)phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | [H]/N=C/c1ccc(COc2ccc([C@@H](C#CC)CC(=O)O)cc2)cc1NCc1cccnc1 |
| InChI | InChI=1S/C26H25N3O3/c1-2-4-22(14-26(30)31)21-8-10-24(11-9-21)32-18-19-6-7-23(15-27)25(13-19)29-17-20-5-3-12-28-16-20/h3,5-13,15-16,22,27,29H,14,17-18H2,1H3,(H,30,31)/b27-15+/t22-/m0/s1 |
| InChIKey | MWCGJOCXQMCOES-QYJQOTDOSA-N |
| XLogP | 4.85 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|