C27H24N2O3 — CID 90132895
(3S)-3-[4-[(2-benzylindazol-5-yl)methoxy]phenyl]hex-4-ynoic acid (PubChem CID 90132895) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is (3S)-3-[4-[(2-benzylindazol-5-yl)methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[(2-benzylindazol-5-yl)methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90132895 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (3S)-3-[4-[(2-benzylindazol-5-yl)methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc3nn(Cc4ccccc4)cc3c2)cc1 |
| InChI | InChI=1S/C27H24N2O3/c1-2-6-23(16-27(30)31)22-10-12-25(13-11-22)32-19-21-9-14-26-24(15-21)18-29(28-26)17-20-7-4-3-5-8-20/h3-5,7-15,18,23H,16-17,19H2,1H3,(H,30,31)/t23-/m0/s1 |
| InChIKey | ZGKMKTSJELUJTM-QHCPKHFHSA-N |
| XLogP | 5.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|