C25H26N2O4 — CID 90133534
3-[4-[[2-[[(3S)-oxolan-3-yl]methyl]indazol-5-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 90133534) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-[4-[[2-[[(3S)-oxolan-3-yl]methyl]indazol-5-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[2-[[(3S)-oxolan-3-yl]methyl]indazol-5-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90133534 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-[4-[[2-[[(3S)-oxolan-3-yl]methyl]indazol-5-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2ccc3nn(C[C@@H]4CCOC4)cc3c2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-2-3-21(13-25(28)29)20-5-7-23(8-6-20)31-17-18-4-9-24-22(12-18)15-27(26-24)14-19-10-11-30-16-19/h4-9,12,15,19,21H,10-11,13-14,16-17H2,1H3,(H,28,29)/t19-,21?/m0/s1 |
| InChIKey | ODVZNPFGQMNQGQ-ZQRQZVKFSA-N |
| XLogP | 4.23 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|