C33H32O5S — CID 121268304
(3S)-3-[4-[[3-[2-methyl-4-(oxan-4-yloxy)phenyl]-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 121268304) has the molecular formula C33H32O5S and a molecular weight of 540.68 g/mol. Its IUPAC name is (3S)-3-[4-[[3-[2-methyl-4-(oxan-4-yloxy)phenyl]-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[3-[2-methyl-4-(oxan-4-yloxy)phenyl]-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 121268304 |
| Molecular Formula | C33H32O5S |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | (3S)-3-[4-[[3-[2-methyl-4-(oxan-4-yloxy)phenyl]-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc3scc(-c4ccc(OC5CCOCC5)cc4C)c3c2)cc1 |
| InChI | InChI=1S/C33H32O5S/c1-3-4-25(19-33(34)35)24-6-8-26(9-7-24)37-20-23-5-12-32-30(18-23)31(21-39-32)29-11-10-28(17-22(29)2)38-27-13-15-36-16-14-27/h5-12,17-18,21,25,27H,13-16,19-20H2,1-2H3,(H,34,35)/t25-/m0/s1 |
| InChIKey | WLQFBQSOKLTELC-VWLOTQADSA-N |
| XLogP | 7.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|