C29H28O5S3 — CID 159759882
(3S)-3-[4-[[3-(2-methyl-4-methylsulfonylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid;sulfane (PubChem CID 159759882) has the molecular formula C29H28O5S3 and a molecular weight of 552.74 g/mol. Its IUPAC name is (3S)-3-[4-[[3-(2-methyl-4-methylsulfonylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid;sulfane.
| Compound Name | (3S)-3-[4-[[3-(2-methyl-4-methylsulfonylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid;sulfane |
|---|---|
| PubChem CID | 159759882 |
| Molecular Formula | C29H28O5S3 |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | (3S)-3-[4-[[3-(2-methyl-4-methylsulfonylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid;sulfane |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc3scc(-c4ccc(S(C)(=O)=O)cc4C)c3c2)cc1.S |
| InChI | InChI=1S/C29H26O5S2.H2S/c1-4-5-22(16-29(30)31)21-7-9-23(10-8-21)34-17-20-6-13-28-26(15-20)27(18-35-28)25-12-11-24(14-19(25)2)36(3,32)33;/h6-15,18,22H,16-17H2,1-3H3,(H,30,31);1H2/t22-;/m0./s1 |
| InChIKey | NESWCTUJNNSMLH-FTBISJDPSA-N |
| XLogP | 6.55 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|