C34H36O6S2 — CID 131747164
ethyl (3S)-3-[4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]-1-benzothiophen-5-yl]oxymethyl]phenyl]hex-4-ynoate (PubChem CID 131747164) has the molecular formula C34H36O6S2 and a molecular weight of 604.79 g/mol. Its IUPAC name is ethyl (3S)-3-[4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]-1-benzothiophen-5-yl]oxymethyl]phenyl]hex-4-ynoate.
| Compound Name | ethyl (3S)-3-[4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]-1-benzothiophen-5-yl]oxymethyl]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 131747164 |
| Molecular Formula | C34H36O6S2 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | ethyl (3S)-3-[4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]-1-benzothiophen-5-yl]oxymethyl]phenyl]hex-4-ynoate |
| SMILES | CC#C[C@@H](CC(=O)OCC)c1ccc(COc2ccc3scc(-c4ccc(OCCCS(C)(=O)=O)cc4C)c3c2)cc1 |
| InChI | InChI=1S/C34H36O6S2/c1-5-8-27(20-34(35)38-6-2)26-11-9-25(10-12-26)22-40-29-14-16-33-31(21-29)32(23-41-33)30-15-13-28(19-24(30)3)39-17-7-18-42(4,36)37/h9-16,19,21,23,27H,6-7,17-18,20,22H2,1-4H3/t27-/m0/s1 |
| InChIKey | SZIBKNPBTKDLKK-MHZLTWQESA-N |
| XLogP | 7.33 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|