C30H28O3S — CID 131747139
ethyl (3S)-3-[4-[[3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoate (PubChem CID 131747139) has the molecular formula C30H28O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is ethyl (3S)-3-[4-[[3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoate.
| Compound Name | ethyl (3S)-3-[4-[[3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 131747139 |
| Molecular Formula | C30H28O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | ethyl (3S)-3-[4-[[3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#C[C@@H](CC(=O)OCC)c1ccc(OCc2ccc3scc(-c4ccccc4C)c3c2)cc1 |
| InChI | InChI=1S/C30H28O3S/c1-4-8-24(18-30(31)32-5-2)23-12-14-25(15-13-23)33-19-22-11-16-29-27(17-22)28(20-34-29)26-10-7-6-9-21(26)3/h6-7,9-17,20,24H,5,18-19H2,1-3H3/t24-/m0/s1 |
| InChIKey | DXZCLHFMYJDYRH-DEOSSOPVSA-N |
| XLogP | 7.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|