C29H27NO2S — CID 131986397
(3S)-3-[4-[[2-methyl-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide (PubChem CID 131986397) has the molecular formula C29H27NO2S and a molecular weight of 453.61 g/mol. Its IUPAC name is (3S)-3-[4-[[2-methyl-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide.
| Compound Name | (3S)-3-[4-[[2-methyl-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide |
|---|---|
| PubChem CID | 131986397 |
| Molecular Formula | C29H27NO2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (3S)-3-[4-[[2-methyl-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide |
| SMILES | CC#C[C@@H](CC(N)=O)c1ccc(OCc2ccc3sc(C)c(-c4ccccc4C)c3c2)cc1 |
| InChI | InChI=1S/C29H27NO2S/c1-4-7-23(17-28(30)31)22-11-13-24(14-12-22)32-18-21-10-15-27-26(16-21)29(20(3)33-27)25-9-6-5-8-19(25)2/h5-6,8-16,23H,17-18H2,1-3H3,(H2,30,31)/t23-/m0/s1 |
| InChIKey | RAZFRWWQASOZEH-QHCPKHFHSA-N |
| XLogP | 6.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|