C33H33N3O3S — CID 158578305
5-[(2S)-2-[4-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-methyl-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-4H-triazole (PubChem CID 158578305) has the molecular formula C33H33N3O3S and a molecular weight of 551.71 g/mol. Its IUPAC name is 5-[(2S)-2-[4-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-methyl-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-4H-triazole.
| Compound Name | 5-[(2S)-2-[4-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-methyl-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-4H-triazole |
|---|---|
| PubChem CID | 158578305 |
| Molecular Formula | C33H33N3O3S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 5-[(2S)-2-[4-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-methyl-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-4H-triazole |
| SMILES | CC#C[C@@H](CC1=NN=NC1)c1ccc(OCc2ccc3sc(C)c(-c4ccc(OCCOC)cc4C)c3c2)cc1 |
| InChI | InChI=1S/C33H33N3O3S/c1-5-6-26(19-27-20-34-36-35-27)25-8-10-28(11-9-25)39-21-24-7-14-32-31(18-24)33(23(3)40-32)30-13-12-29(17-22(30)2)38-16-15-37-4/h7-14,17-18,26H,15-16,19-21H2,1-4H3/t26-/m0/s1 |
| InChIKey | GPUKBOFPPZATFS-SANMLTNESA-N |
| XLogP | 8.11 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|