C19H18ClFO2S — CID 131986170
5-(chloromethyl)-2-fluoro-3-[4-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophene (PubChem CID 131986170) has the molecular formula C19H18ClFO2S and a molecular weight of 364.87 g/mol. Its IUPAC name is 5-(chloromethyl)-2-fluoro-3-[4-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophene.
| Compound Name | 5-(chloromethyl)-2-fluoro-3-[4-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophene |
|---|---|
| PubChem CID | 131986170 |
| Molecular Formula | C19H18ClFO2S |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 5-(chloromethyl)-2-fluoro-3-[4-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophene |
| SMILES | COCCOc1ccc(-c2c(F)sc3ccc(CCl)cc23)c(C)c1 |
| InChI | InChI=1S/C19H18ClFO2S/c1-12-9-14(23-8-7-22-2)4-5-15(12)18-16-10-13(11-20)3-6-17(16)24-19(18)21/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | FOMHXKWLJXPMNB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|