C28H27NO5S — CID 145384693
3-[6-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]but-3-enoic acid (PubChem CID 145384693) has the molecular formula C28H27NO5S and a molecular weight of 489.59 g/mol. Its IUPAC name is 3-[6-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]but-3-enoic acid.
| Compound Name | 3-[6-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]but-3-enoic acid |
|---|---|
| PubChem CID | 145384693 |
| Molecular Formula | C28H27NO5S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 3-[6-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]but-3-enoic acid |
| SMILES | C=C(CC(=O)O)c1ccc(OCc2ccc3scc(-c4ccc(OCCOC)cc4C)c3c2)nc1 |
| InChI | InChI=1S/C28H27NO5S/c1-18(13-28(30)31)21-5-9-27(29-15-21)34-16-20-4-8-26-24(14-20)25(17-35-26)23-7-6-22(12-19(23)2)33-11-10-32-3/h4-9,12,14-15,17H,1,10-11,13,16H2,2-3H3,(H,30,31) |
| InChIKey | YKUWYEQEENKXOC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|