C20H19F3O3S — CID 131986255
[3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-(trifluoromethyl)-1-benzothiophen-5-yl]methanol (PubChem CID 131986255) has the molecular formula C20H19F3O3S and a molecular weight of 396.43 g/mol. Its IUPAC name is [3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-(trifluoromethyl)-1-benzothiophen-5-yl]methanol.
| Compound Name | [3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-(trifluoromethyl)-1-benzothiophen-5-yl]methanol |
|---|---|
| PubChem CID | 131986255 |
| Molecular Formula | C20H19F3O3S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-(trifluoromethyl)-1-benzothiophen-5-yl]methanol |
| SMILES | COCCOc1ccc(-c2c(C(F)(F)F)sc3ccc(CO)cc23)c(C)c1 |
| InChI | InChI=1S/C20H19F3O3S/c1-12-9-14(26-8-7-25-2)4-5-15(12)18-16-10-13(11-24)3-6-17(16)27-19(18)20(21,22)23/h3-6,9-10,24H,7-8,11H2,1-2H3 |
| InChIKey | AHUDLFBSMLLVPB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|