C22H28O4 — CID 145122895
[4-(2,4-dimethylphenyl)-3-(2-methoxyethoxy)phenyl]methanol;2-methylprop-2-enal (PubChem CID 145122895) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is [4-(2,4-dimethylphenyl)-3-(2-methoxyethoxy)phenyl]methanol;2-methylprop-2-enal.
| Compound Name | [4-(2,4-dimethylphenyl)-3-(2-methoxyethoxy)phenyl]methanol;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122895 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [4-(2,4-dimethylphenyl)-3-(2-methoxyethoxy)phenyl]methanol;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.COCCOc1cc(CO)ccc1-c1ccc(C)cc1C |
| InChI | InChI=1S/C18H22O3.C4H6O/c1-13-4-6-16(14(2)10-13)17-7-5-15(12-19)11-18(17)21-9-8-20-3;1-4(2)3-5/h4-7,10-11,19H,8-9,12H2,1-3H3;3H,1H2,2H3 |
| InChIKey | CNWLDKLQDSAIFQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|