C31H32O6S2 — CID 131999422
3-[4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]-1-benzothiophen-5-yl]methoxy]phenyl]pent-4-enoic acid (PubChem CID 131999422) has the molecular formula C31H32O6S2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 3-[4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]-1-benzothiophen-5-yl]methoxy]phenyl]pent-4-enoic acid.
| Compound Name | 3-[4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]-1-benzothiophen-5-yl]methoxy]phenyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 131999422 |
| Molecular Formula | C31H32O6S2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 3-[4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]-1-benzothiophen-5-yl]methoxy]phenyl]pent-4-enoic acid |
| SMILES | C=CC(CC(=O)O)c1ccc(OCc2ccc3scc(-c4ccc(OCCCS(C)(=O)=O)cc4C)c3c2)cc1 |
| InChI | InChI=1S/C31H32O6S2/c1-4-23(18-31(32)33)24-7-9-25(10-8-24)37-19-22-6-13-30-28(17-22)29(20-38-30)27-12-11-26(16-21(27)2)36-14-5-15-39(3,34)35/h4,6-13,16-17,20,23H,1,5,14-15,18-19H2,2-3H3,(H,32,33) |
| InChIKey | OSPKVJDLVMRTSM-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|