C28H24O4S — CID 121268481
(3S)-3-[4-[[3-(4-hydroxy-2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 121268481) has the molecular formula C28H24O4S and a molecular weight of 456.56 g/mol. Its IUPAC name is (3S)-3-[4-[[3-(4-hydroxy-2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[3-(4-hydroxy-2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 121268481 |
| Molecular Formula | C28H24O4S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (3S)-3-[4-[[3-(4-hydroxy-2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc3scc(-c4ccc(O)cc4C)c3c2)cc1 |
| InChI | InChI=1S/C28H24O4S/c1-3-4-21(15-28(30)31)20-6-9-23(10-7-20)32-16-19-5-12-27-25(14-19)26(17-33-27)24-11-8-22(29)13-18(24)2/h5-14,17,21,29H,15-16H2,1-2H3,(H,30,31)/t21-/m0/s1 |
| InChIKey | DELVXQXRBCCXHY-NRFANRHFSA-N |
| XLogP | 6.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|