C27H22BrNO2S — CID 131986197
(3S)-3-[4-[[3-(2-bromophenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide (PubChem CID 131986197) has the molecular formula C27H22BrNO2S and a molecular weight of 504.45 g/mol. Its IUPAC name is (3S)-3-[4-[[3-(2-bromophenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide.
| Compound Name | (3S)-3-[4-[[3-(2-bromophenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide |
|---|---|
| PubChem CID | 131986197 |
| Molecular Formula | C27H22BrNO2S |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | (3S)-3-[4-[[3-(2-bromophenyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide |
| SMILES | CC#C[C@@H](CC(N)=O)c1ccc(OCc2ccc3scc(-c4ccccc4Br)c3c2)cc1 |
| InChI | InChI=1S/C27H22BrNO2S/c1-2-5-20(15-27(29)30)19-9-11-21(12-10-19)31-16-18-8-13-26-23(14-18)24(17-32-26)22-6-3-4-7-25(22)28/h3-4,6-14,17,20H,15-16H2,1H3,(H2,29,30)/t20-/m0/s1 |
| InChIKey | DOWMYEYAZLRAOA-FQEVSTJZSA-N |
| XLogP | 6.89 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|