C32H30N2O3S — CID 131986129
(3S)-3-[4-[[3-(1-propanoyl-2,3-dihydroindol-4-yl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide (PubChem CID 131986129) has the molecular formula C32H30N2O3S and a molecular weight of 522.67 g/mol. Its IUPAC name is (3S)-3-[4-[[3-(1-propanoyl-2,3-dihydroindol-4-yl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide.
| Compound Name | (3S)-3-[4-[[3-(1-propanoyl-2,3-dihydroindol-4-yl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide |
|---|---|
| PubChem CID | 131986129 |
| Molecular Formula | C32H30N2O3S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | (3S)-3-[4-[[3-(1-propanoyl-2,3-dihydroindol-4-yl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynamide |
| SMILES | CC#C[C@@H](CC(N)=O)c1ccc(OCc2ccc3scc(-c4cccc5c4CCN5C(=O)CC)c3c2)cc1 |
| InChI | InChI=1S/C32H30N2O3S/c1-3-6-23(18-31(33)35)22-10-12-24(13-11-22)37-19-21-9-14-30-27(17-21)28(20-38-30)25-7-5-8-29-26(25)15-16-34(29)32(36)4-2/h5,7-14,17,20,23H,4,15-16,18-19H2,1-2H3,(H2,33,35)/t23-/m0/s1 |
| InChIKey | KRICZQOEQDUTNU-QHCPKHFHSA-N |
| XLogP | 6.43 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|