C28H25NO4S — CID 121268592
3-[4-[[3-(6-methoxy-2-methyl-3-pyridinyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 121268592) has the molecular formula C28H25NO4S and a molecular weight of 471.58 g/mol. Its IUPAC name is 3-[4-[[3-(6-methoxy-2-methyl-3-pyridinyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[3-(6-methoxy-2-methyl-3-pyridinyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 121268592 |
| Molecular Formula | C28H25NO4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-[4-[[3-(6-methoxy-2-methyl-3-pyridinyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2ccc3scc(-c4ccc(OC)nc4C)c3c2)cc1 |
| InChI | InChI=1S/C28H25NO4S/c1-4-5-21(15-28(30)31)20-7-9-22(10-8-20)33-16-19-6-12-26-24(14-19)25(17-34-26)23-11-13-27(32-3)29-18(23)2/h6-14,17,21H,15-16H2,1-3H3,(H,30,31) |
| InChIKey | HPEATIYWOZAFOL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|