C30H29NO5S — CID 121268505
3-[6-[[3-[3-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid (PubChem CID 121268505) has the molecular formula C30H29NO5S and a molecular weight of 515.63 g/mol. Its IUPAC name is 3-[6-[[3-[3-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid.
| Compound Name | 3-[6-[[3-[3-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 121268505 |
| Molecular Formula | C30H29NO5S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 3-[6-[[3-[3-(2-methoxyethoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2ccc3scc(-c4cccc(OCCOC)c4C)c3c2)nc1 |
| InChI | InChI=1S/C30H29NO5S/c1-4-6-22(16-30(32)33)23-10-12-29(31-17-23)36-18-21-9-11-28-25(15-21)26(19-37-28)24-7-5-8-27(20(24)2)35-14-13-34-3/h5,7-12,15,17,19,22H,13-14,16,18H2,1-3H3,(H,32,33) |
| InChIKey | YCLNDYASFVMVKG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|