C26H21NO4S — CID 145384675
(3R)-3-[4-[[3-(3-methoxy-4-pyridinyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-4-ynoic acid (PubChem CID 145384675) has the molecular formula C26H21NO4S and a molecular weight of 443.52 g/mol. Its IUPAC name is (3R)-3-[4-[[3-(3-methoxy-4-pyridinyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-4-ynoic acid.
| Compound Name | (3R)-3-[4-[[3-(3-methoxy-4-pyridinyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 145384675 |
| Molecular Formula | C26H21NO4S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (3R)-3-[4-[[3-(3-methoxy-4-pyridinyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-4-ynoic acid |
| SMILES | C#C[C@@H](CC(=O)O)c1ccc(OCc2ccc3scc(-c4ccncc4OC)c3c2)cc1 |
| InChI | InChI=1S/C26H21NO4S/c1-3-18(13-26(28)29)19-5-7-20(8-6-19)31-15-17-4-9-25-22(12-17)23(16-32-25)21-10-11-27-14-24(21)30-2/h1,4-12,14,16,18H,13,15H2,2H3,(H,28,29)/t18-/m0/s1 |
| InChIKey | NDMYMSGMNHWLRG-SFHVURJKSA-N |
| XLogP | 5.74 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|