C17H18ClF2NO3 — CID 160891004
3-chloro-1-(2,2-difluoroethyl)-6-[4-(2-methoxyethoxy)-2-methylphenyl]pyridin-2-one (PubChem CID 160891004) has the molecular formula C17H18ClF2NO3 and a molecular weight of 357.78 g/mol. Its IUPAC name is 3-chloro-1-(2,2-difluoroethyl)-6-[4-(2-methoxyethoxy)-2-methylphenyl]pyridin-2-one.
| Compound Name | 3-chloro-1-(2,2-difluoroethyl)-6-[4-(2-methoxyethoxy)-2-methylphenyl]pyridin-2-one |
|---|---|
| PubChem CID | 160891004 |
| Molecular Formula | C17H18ClF2NO3 |
| Molecular Weight | 357.78 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-chloro-1-(2,2-difluoroethyl)-6-[4-(2-methoxyethoxy)-2-methylphenyl]pyridin-2-one |
| SMILES | COCCOc1ccc(-c2ccc(Cl)c(=O)n2CC(F)F)c(C)c1 |
| InChI | InChI=1S/C17H18ClF2NO3/c1-11-9-12(24-8-7-23-2)3-4-13(11)15-6-5-14(18)17(22)21(15)10-16(19)20/h3-6,9,16H,7-8,10H2,1-2H3 |
| InChIKey | IJCMVUFTBOLZLR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|