C14H11BrF2INO2 — CID 159368712
6-(2-bromo-4-methoxyphenyl)-1-(2,2-difluoroethyl)-3-iodopyridin-2-one (PubChem CID 159368712) has the molecular formula C14H11BrF2INO2 and a molecular weight of 470.05 g/mol. Its IUPAC name is 6-(2-bromo-4-methoxyphenyl)-1-(2,2-difluoroethyl)-3-iodopyridin-2-one.
| Compound Name | 6-(2-bromo-4-methoxyphenyl)-1-(2,2-difluoroethyl)-3-iodopyridin-2-one |
|---|---|
| PubChem CID | 159368712 |
| Molecular Formula | C14H11BrF2INO2 |
| Molecular Weight | 470.05 g/mol |
| Exact Mass | 468.90 |
| IUPAC Name | 6-(2-bromo-4-methoxyphenyl)-1-(2,2-difluoroethyl)-3-iodopyridin-2-one |
| SMILES | COc1ccc(-c2ccc(I)c(=O)n2CC(F)F)c(Br)c1 |
| InChI | InChI=1S/C14H11BrF2INO2/c1-21-8-2-3-9(10(15)6-8)12-5-4-11(18)14(20)19(12)7-13(16)17/h2-6,13H,7H2,1H3 |
| InChIKey | UTIXAPXHBJAURH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.05 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|