C17H13Br2F2NO2 — CID 148869739
3-bromo-6-(2-bromo-4-but-2-ynoxyphenyl)-1-(2,2-difluoroethyl)pyridin-2-one (PubChem CID 148869739) has the molecular formula C17H13Br2F2NO2 and a molecular weight of 461.10 g/mol. Its IUPAC name is 3-bromo-6-(2-bromo-4-but-2-ynoxyphenyl)-1-(2,2-difluoroethyl)pyridin-2-one.
| Compound Name | 3-bromo-6-(2-bromo-4-but-2-ynoxyphenyl)-1-(2,2-difluoroethyl)pyridin-2-one |
|---|---|
| PubChem CID | 148869739 |
| Molecular Formula | C17H13Br2F2NO2 |
| Molecular Weight | 461.10 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | 3-bromo-6-(2-bromo-4-but-2-ynoxyphenyl)-1-(2,2-difluoroethyl)pyridin-2-one |
| SMILES | CC#CCOc1ccc(-c2ccc(Br)c(=O)n2CC(F)F)c(Br)c1 |
| InChI | InChI=1S/C17H13Br2F2NO2/c1-2-3-8-24-11-4-5-12(14(19)9-11)15-7-6-13(18)17(23)22(15)10-16(20)21/h4-7,9,16H,8,10H2,1H3 |
| InChIKey | GDLKZWXXWJEQKJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.10 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|