C16H16BrF2NO3 — CID 158395133
3-bromo-1-(2,2-difluoroethyl)-6-[4-(methoxymethoxy)-2-methylphenyl]pyridin-2-one (PubChem CID 158395133) has the molecular formula C16H16BrF2NO3 and a molecular weight of 388.21 g/mol. Its IUPAC name is 3-bromo-1-(2,2-difluoroethyl)-6-[4-(methoxymethoxy)-2-methylphenyl]pyridin-2-one.
| Compound Name | 3-bromo-1-(2,2-difluoroethyl)-6-[4-(methoxymethoxy)-2-methylphenyl]pyridin-2-one |
|---|---|
| PubChem CID | 158395133 |
| Molecular Formula | C16H16BrF2NO3 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 3-bromo-1-(2,2-difluoroethyl)-6-[4-(methoxymethoxy)-2-methylphenyl]pyridin-2-one |
| SMILES | COCOc1ccc(-c2ccc(Br)c(=O)n2CC(F)F)c(C)c1 |
| InChI | InChI=1S/C16H16BrF2NO3/c1-10-7-11(23-9-22-2)3-4-12(10)14-6-5-13(17)16(21)20(14)8-15(18)19/h3-7,15H,8-9H2,1-2H3 |
| InChIKey | QTEVXQPLEKFQRZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|