C17H20BrNO3 — CID 160746316
3-bromo-1-ethyl-6-[4-(2-methoxyethoxy)-2-methylphenyl]pyridin-2-one (PubChem CID 160746316) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is 3-bromo-1-ethyl-6-[4-(2-methoxyethoxy)-2-methylphenyl]pyridin-2-one.
| Compound Name | 3-bromo-1-ethyl-6-[4-(2-methoxyethoxy)-2-methylphenyl]pyridin-2-one |
|---|---|
| PubChem CID | 160746316 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 3-bromo-1-ethyl-6-[4-(2-methoxyethoxy)-2-methylphenyl]pyridin-2-one |
| SMILES | CCn1c(-c2ccc(OCCOC)cc2C)ccc(Br)c1=O |
| InChI | InChI=1S/C17H20BrNO3/c1-4-19-16(8-7-15(18)17(19)20)14-6-5-13(11-12(14)2)22-10-9-21-3/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | XBTZULOROMPPLF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|