C16H17ClINO3 — CID 146946992
6-[2-chloro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodopyridin-2-one (PubChem CID 146946992) has the molecular formula C16H17ClINO3 and a molecular weight of 433.67 g/mol. Its IUPAC name is 6-[2-chloro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodopyridin-2-one.
| Compound Name | 6-[2-chloro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodopyridin-2-one |
|---|---|
| PubChem CID | 146946992 |
| Molecular Formula | C16H17ClINO3 |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | 6-[2-chloro-4-(2-methoxyethoxy)phenyl]-1-ethyl-3-iodopyridin-2-one |
| SMILES | CCn1c(-c2ccc(OCCOC)cc2Cl)ccc(I)c1=O |
| InChI | InChI=1S/C16H17ClINO3/c1-3-19-15(7-6-14(18)16(19)20)12-5-4-11(10-13(12)17)22-9-8-21-2/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | JCNFBTCQQSBQRI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|