C15H14BrF2NO3 — CID 148744943
3-bromo-6-[2,6-difluoro-4-(methoxymethoxy)phenyl]-1-ethylpyridin-2-one (PubChem CID 148744943) has the molecular formula C15H14BrF2NO3 and a molecular weight of 374.18 g/mol. Its IUPAC name is 3-bromo-6-[2,6-difluoro-4-(methoxymethoxy)phenyl]-1-ethylpyridin-2-one.
| Compound Name | 3-bromo-6-[2,6-difluoro-4-(methoxymethoxy)phenyl]-1-ethylpyridin-2-one |
|---|---|
| PubChem CID | 148744943 |
| Molecular Formula | C15H14BrF2NO3 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 3-bromo-6-[2,6-difluoro-4-(methoxymethoxy)phenyl]-1-ethylpyridin-2-one |
| SMILES | CCn1c(-c2c(F)cc(OCOC)cc2F)ccc(Br)c1=O |
| InChI | InChI=1S/C15H14BrF2NO3/c1-3-19-13(5-4-10(16)15(19)20)14-11(17)6-9(7-12(14)18)22-8-21-2/h4-7H,3,8H2,1-2H3 |
| InChIKey | OQRHVMWCUNRBBN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|