C14H10F4INO2 — CID 160605392
1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-methoxyphenyl)-3-iodopyridin-2-one (PubChem CID 160605392) has the molecular formula C14H10F4INO2 and a molecular weight of 427.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-methoxyphenyl)-3-iodopyridin-2-one.
| Compound Name | 1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-methoxyphenyl)-3-iodopyridin-2-one |
|---|---|
| PubChem CID | 160605392 |
| Molecular Formula | C14H10F4INO2 |
| Molecular Weight | 427.14 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-methoxyphenyl)-3-iodopyridin-2-one |
| SMILES | COc1cc(F)c(-c2ccc(I)c(=O)n2CC(F)F)c(F)c1 |
| InChI | InChI=1S/C14H10F4INO2/c1-22-7-4-8(15)13(9(16)5-7)11-3-2-10(19)14(21)20(11)6-12(17)18/h2-5,12H,6H2,1H3 |
| InChIKey | OVTXSHMOIYCAHK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|