C15H13Br2F2NO2S — CID 158796658
3-bromo-6-[2-bromo-4-(methylsulfanylmethoxy)phenyl]-1-(2,2-difluoroethyl)pyridin-2-one (PubChem CID 158796658) has the molecular formula C15H13Br2F2NO2S and a molecular weight of 469.15 g/mol. Its IUPAC name is 3-bromo-6-[2-bromo-4-(methylsulfanylmethoxy)phenyl]-1-(2,2-difluoroethyl)pyridin-2-one.
| Compound Name | 3-bromo-6-[2-bromo-4-(methylsulfanylmethoxy)phenyl]-1-(2,2-difluoroethyl)pyridin-2-one |
|---|---|
| PubChem CID | 158796658 |
| Molecular Formula | C15H13Br2F2NO2S |
| Molecular Weight | 469.15 g/mol |
| Exact Mass | 466.90 |
| IUPAC Name | 3-bromo-6-[2-bromo-4-(methylsulfanylmethoxy)phenyl]-1-(2,2-difluoroethyl)pyridin-2-one |
| SMILES | CSCOc1ccc(-c2ccc(Br)c(=O)n2CC(F)F)c(Br)c1 |
| InChI | InChI=1S/C15H13Br2F2NO2S/c1-23-8-22-9-2-3-10(12(17)6-9)13-5-4-11(16)15(21)20(13)7-14(18)19/h2-6,14H,7-8H2,1H3 |
| InChIKey | SPAYLGSQFNOJPQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.15 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|